C21H17FO7S — CID 55388544
dimethyl 5-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]oxybenzene-1,3-dicarboxylate (PubChem CID 55388544) has the molecular formula C21H17FO7S and a molecular weight of 432.43 g/mol. Its IUPAC name is dimethyl 5-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55388544 |
| Molecular Formula | C21H17FO7S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | dimethyl 5-[4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carbonyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COCc1c(C(=O)Oc2cc(C(=O)OC)cc(C(=O)OC)c2)sc2cccc(F)c12 |
| InChI | InChI=1S/C21H17FO7S/c1-26-10-14-17-15(22)5-4-6-16(17)30-18(14)21(25)29-13-8-11(19(23)27-2)7-12(9-13)20(24)28-3/h4-9H,10H2,1-3H3 |
| InChIKey | LDMURKGBDJXGST-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|