C20H17FO5S — CID 7698060
ethyl 4-fluoro-3-[(4-methoxycarbonylphenoxy)methyl]-1-benzothiophene-2-carboxylate (PubChem CID 7698060) has the molecular formula C20H17FO5S and a molecular weight of 388.42 g/mol. Its IUPAC name is ethyl 4-fluoro-3-[(4-methoxycarbonylphenoxy)methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4-fluoro-3-[(4-methoxycarbonylphenoxy)methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7698060 |
| Molecular Formula | C20H17FO5S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | ethyl 4-fluoro-3-[(4-methoxycarbonylphenoxy)methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1COc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H17FO5S/c1-3-25-20(23)18-14(17-15(21)5-4-6-16(17)27-18)11-26-13-9-7-12(8-10-13)19(22)24-2/h4-10H,3,11H2,1-2H3 |
| InChIKey | GDDBAQSMBQDSEN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |