C23H17FN2O3S — CID 46510072
N'-benzoyl-4-fluoro-3-(phenoxymethyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 46510072) has the molecular formula C23H17FN2O3S and a molecular weight of 420.47 g/mol. Its IUPAC name is N'-benzoyl-4-fluoro-3-(phenoxymethyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-benzoyl-4-fluoro-3-(phenoxymethyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 46510072 |
| Molecular Formula | C23H17FN2O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N'-benzoyl-4-fluoro-3-(phenoxymethyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sc2cccc(F)c2c1COc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17FN2O3S/c24-18-12-7-13-19-20(18)17(14-29-16-10-5-2-6-11-16)21(30-19)23(28)26-25-22(27)15-8-3-1-4-9-15/h1-13H,14H2,(H,25,27)(H,26,28) |
| InChIKey | NOWLLBSPPJTXML-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|