C22H21FN2O2S — CID 120660147
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(phenoxymethyl)-1-benzothiophen-2-yl]methanone (PubChem CID 120660147) has the molecular formula C22H21FN2O2S and a molecular weight of 396.49 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(phenoxymethyl)-1-benzothiophen-2-yl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(phenoxymethyl)-1-benzothiophen-2-yl]methanone |
|---|---|
| PubChem CID | 120660147 |
| Molecular Formula | C22H21FN2O2S |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-fluoro-3-(phenoxymethyl)-1-benzothiophen-2-yl]methanone |
| SMILES | O=C(c1sc2cccc(F)c2c1COc1ccccc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C22H21FN2O2S/c23-18-7-4-8-19-20(18)17(13-27-16-5-2-1-3-6-16)21(28-19)22(26)25-11-14-9-24-10-15(14)12-25/h1-8,14-15,24H,9-13H2/t14-,15+ |
| InChIKey | XBEOKMJCOVCZSC-GASCZTMLSA-N |
| XLogP | 3.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |