C25H20F2N2O3S — CID 55974311
4-fluoro-N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 55974311) has the molecular formula C25H20F2N2O3S and a molecular weight of 466.51 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55974311 |
| Molecular Formula | C25H20F2N2O3S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 4-fluoro-N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1sc2cccc(F)c2c1COc1ccccc1)c1ccccc1F |
| InChI | InChI=1S/C25H20F2N2O3S/c26-19-10-5-4-9-17(19)24(30)28-13-14-29-25(31)23-18(15-32-16-7-2-1-3-8-16)22-20(27)11-6-12-21(22)33-23/h1-12H,13-15H2,(H,28,30)(H,29,31) |
| InChIKey | DRELILSOWKNABZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|