C19H18FNO3S — CID 78854502
4-fluoro-N-(3-hydroxypropyl)-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 78854502) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxypropyl)-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(3-hydroxypropyl)-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 78854502 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-fluoro-N-(3-hydroxypropyl)-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCO)c1sc2cccc(F)c2c1COc1ccccc1 |
| InChI | InChI=1S/C19H18FNO3S/c20-15-8-4-9-16-17(15)14(12-24-13-6-2-1-3-7-13)18(25-16)19(23)21-10-5-11-22/h1-4,6-9,22H,5,10-12H2,(H,21,23) |
| InChIKey | RCJNTDQFLJSAMM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|