C25H25FN4O3S — CID 55866632
4-fluoro-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 55866632) has the molecular formula C25H25FN4O3S and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-fluoro-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55866632 |
| Molecular Formula | C25H25FN4O3S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 4-fluoro-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(phenoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCn1nc2n(c1=O)CCCC2)c1sc2cccc(F)c2c1COc1ccccc1 |
| InChI | InChI=1S/C25H25FN4O3S/c26-19-10-6-11-20-22(19)18(16-33-17-8-2-1-3-9-17)23(34-20)24(31)27-13-7-15-30-25(32)29-14-5-4-12-21(29)28-30/h1-3,6,8-11H,4-5,7,12-16H2,(H,27,31) |
| InChIKey | MXFTXCYYAYSKKW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|