C21H19FO4S — CID 7700414
ethyl 4-fluoro-3-[(4-propanoylphenoxy)methyl]-1-benzothiophene-2-carboxylate (PubChem CID 7700414) has the molecular formula C21H19FO4S and a molecular weight of 386.44 g/mol. Its IUPAC name is ethyl 4-fluoro-3-[(4-propanoylphenoxy)methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4-fluoro-3-[(4-propanoylphenoxy)methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7700414 |
| Molecular Formula | C21H19FO4S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | ethyl 4-fluoro-3-[(4-propanoylphenoxy)methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1COc1ccc(C(=O)CC)cc1 |
| InChI | InChI=1S/C21H19FO4S/c1-3-17(23)13-8-10-14(11-9-13)26-12-15-19-16(22)6-5-7-18(19)27-20(15)21(24)25-4-2/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | GRIBGYLXGUWEQL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |