C19H16F2O4S — CID 7736082
2-(4-fluorophenoxy)ethyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 7736082) has the molecular formula C19H16F2O4S and a molecular weight of 378.40 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7736082 |
| Molecular Formula | C19H16F2O4S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | COCc1c(C(=O)OCCOc2ccc(F)cc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C19H16F2O4S/c1-23-11-14-17-15(21)3-2-4-16(17)26-18(14)19(22)25-10-9-24-13-7-5-12(20)6-8-13/h2-8H,9-11H2,1H3 |
| InChIKey | YJKCBYZXFNQTIH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|