C18H14BrFO3S — CID 7736143
(3-bromophenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate (PubChem CID 7736143) has the molecular formula C18H14BrFO3S and a molecular weight of 409.28 g/mol. Its IUPAC name is (3-bromophenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate.
| Compound Name | (3-bromophenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7736143 |
| Molecular Formula | C18H14BrFO3S |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | (3-bromophenyl)methyl 4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxylate |
| SMILES | COCc1c(C(=O)OCc2cccc(Br)c2)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H14BrFO3S/c1-22-10-13-16-14(20)6-3-7-15(16)24-17(13)18(21)23-9-11-4-2-5-12(19)8-11/h2-8H,9-10H2,1H3 |
| InChIKey | TWWCODAQSBZCMO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |