C22H19FO5S — CID 7700491
ethyl 4-fluoro-3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxymethyl]-1-benzothiophene-2-carboxylate (PubChem CID 7700491) has the molecular formula C22H19FO5S and a molecular weight of 414.45 g/mol. Its IUPAC name is ethyl 4-fluoro-3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxymethyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4-fluoro-3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxymethyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7700491 |
| Molecular Formula | C22H19FO5S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | ethyl 4-fluoro-3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]oxymethyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1COC(=O)/C=C/c1cccc(OC)c1 |
| InChI | InChI=1S/C22H19FO5S/c1-3-27-22(25)21-16(20-17(23)8-5-9-18(20)29-21)13-28-19(24)11-10-14-6-4-7-15(12-14)26-2/h4-12H,3,13H2,1-2H3/b11-10+ |
| InChIKey | ZGJRJFVMEYXKOK-ZHACJKMWSA-N |
| XLogP | 4.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|