C16H20O4S2 — CID 118186346
5-O-butyl 2-O-ethyl 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylate (PubChem CID 118186346) has the molecular formula C16H20O4S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 5-O-butyl 2-O-ethyl 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylate.
| Compound Name | 5-O-butyl 2-O-ethyl 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 118186346 |
| Molecular Formula | C16H20O4S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 5-O-butyl 2-O-ethyl 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarboxylate |
| SMILES | CCCCOC(=O)c1sc2sc(C(=O)OCC)c(C)c2c1C |
| InChI | InChI=1S/C16H20O4S2/c1-5-7-8-20-15(18)13-10(4)11-9(3)12(14(17)19-6-2)21-16(11)22-13/h5-8H2,1-4H3 |
| InChIKey | DQHUSLASBVFRNN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|