C16H16O4S — CID 118658260
ethyl 4,7-diacetyl-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 118658260) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is ethyl 4,7-diacetyl-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4,7-diacetyl-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 118658260 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | ethyl 4,7-diacetyl-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(C(C)=O)ccc(C(C)=O)c2c1C |
| InChI | InChI=1S/C16H16O4S/c1-5-20-16(19)14-8(2)13-11(9(3)17)6-7-12(10(4)18)15(13)21-14/h6-7H,5H2,1-4H3 |
| InChIKey | ZZVHMHHJYFCUMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |