C24H18F2O4S2 — CID 134386122
diethyl 3,6-bis(4-fluorophenyl)thieno[3,2-b]thiophene-2,5-dicarboxylate (PubChem CID 134386122) has the molecular formula C24H18F2O4S2 and a molecular weight of 472.53 g/mol. Its IUPAC name is diethyl 3,6-bis(4-fluorophenyl)thieno[3,2-b]thiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3,6-bis(4-fluorophenyl)thieno[3,2-b]thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 134386122 |
| Molecular Formula | C24H18F2O4S2 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | diethyl 3,6-bis(4-fluorophenyl)thieno[3,2-b]thiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc2c(-c3ccc(F)cc3)c(C(=O)OCC)sc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18F2O4S2/c1-3-29-23(27)21-17(13-5-9-15(25)10-6-13)19-20(31-21)18(14-7-11-16(26)12-8-14)22(32-19)24(28)30-4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | MNAWHUCXVAHUGX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |