C17H12F2O2S — CID 168781030
ethyl 6,7-difluoro-3-phenyl-1-benzothiophene-2-carboxylate (PubChem CID 168781030) has the molecular formula C17H12F2O2S and a molecular weight of 318.34 g/mol. Its IUPAC name is ethyl 6,7-difluoro-3-phenyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 6,7-difluoro-3-phenyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168781030 |
| Molecular Formula | C17H12F2O2S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | ethyl 6,7-difluoro-3-phenyl-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(F)c(F)ccc2c1-c1ccccc1 |
| InChI | InChI=1S/C17H12F2O2S/c1-2-21-17(20)16-13(10-6-4-3-5-7-10)11-8-9-12(18)14(19)15(11)22-16/h3-9H,2H2,1H3 |
| InChIKey | TYBIDDRTEAQPPB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |