C15H15NO4S — CID 64891834
2-O-ethyl 4-O-methyl 5-amino-3-phenylthiophene-2,4-dicarboxylate (PubChem CID 64891834) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-O-ethyl 4-O-methyl 5-amino-3-phenylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-methyl 5-amino-3-phenylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 64891834 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-O-ethyl 4-O-methyl 5-amino-3-phenylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C(=O)OC)c1-c1ccccc1 |
| InChI | InChI=1S/C15H15NO4S/c1-3-20-15(18)12-10(9-7-5-4-6-8-9)11(13(16)21-12)14(17)19-2/h4-8H,3,16H2,1-2H3 |
| InChIKey | YFMLLZBPOKAIKZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|