C21H17N3O2S — CID 1241263
ethyl 5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carboxylate (PubChem CID 1241263) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl 5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carboxylate.
| Compound Name | ethyl 5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carboxylate |
|---|---|
| PubChem CID | 1241263 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | ethyl 5-amino-3,4-diphenylthieno[2,3-c]pyridazine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nnc(-c3ccccc3)c(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C21H17N3O2S/c1-2-26-21(25)19-17(22)16-15(13-9-5-3-6-10-13)18(23-24-20(16)27-19)14-11-7-4-8-12-14/h3-12H,2,22H2,1H3 |
| InChIKey | ZETNLSPJEBYALN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |