C23H17N3O3S — CID 10621778
ethyl 5-amino-11,12-diphenyl-3-oxa-7-thia-9,10-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene-4-carboxylate (PubChem CID 10621778) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl 5-amino-11,12-diphenyl-3-oxa-7-thia-9,10-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene-4-carboxylate.
| Compound Name | ethyl 5-amino-11,12-diphenyl-3-oxa-7-thia-9,10-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 10621778 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | ethyl 5-amino-11,12-diphenyl-3-oxa-7-thia-9,10-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaene-4-carboxylate |
| SMILES | CCOC(=O)c1oc2c(sc3nnc(-c4ccccc4)c(-c4ccccc4)c32)c1N |
| InChI | InChI=1S/C23H17N3O3S/c1-2-28-23(27)20-17(24)21-19(29-20)16-15(13-9-5-3-6-10-13)18(25-26-22(16)30-21)14-11-7-4-8-12-14/h3-12H,2,24H2,1H3 |
| InChIKey | YNHJDJADKCASJG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |