C21H14N4S — CID 101110536
12,13-diphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-amine (PubChem CID 101110536) has the molecular formula C21H14N4S and a molecular weight of 354.44 g/mol. Its IUPAC name is 12,13-diphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-amine.
| Compound Name | 12,13-diphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-amine |
|---|---|
| PubChem CID | 101110536 |
| Molecular Formula | C21H14N4S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 12,13-diphenyl-8-thia-3,10,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-amine |
| SMILES | Nc1ccc2sc3nnc(-c4ccccc4)c(-c4ccccc4)c3c2n1 |
| InChI | InChI=1S/C21H14N4S/c22-16-12-11-15-20(23-16)18-17(13-7-3-1-4-8-13)19(24-25-21(18)26-15)14-9-5-2-6-10-14/h1-12H,(H2,22,23) |
| InChIKey | RIDCDYRSKIAITP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |