C18H13N3S — CID 15357980
3-methyl-4,5-diphenyl-[1,2]thiazolo[5,4-c]pyridazine (PubChem CID 15357980) has the molecular formula C18H13N3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-methyl-4,5-diphenyl-[1,2]thiazolo[5,4-c]pyridazine.
| Compound Name | 3-methyl-4,5-diphenyl-[1,2]thiazolo[5,4-c]pyridazine |
|---|---|
| PubChem CID | 15357980 |
| Molecular Formula | C18H13N3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-methyl-4,5-diphenyl-[1,2]thiazolo[5,4-c]pyridazine |
| SMILES | Cc1nsc2nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H13N3S/c1-12-15-16(13-8-4-2-5-9-13)17(14-10-6-3-7-11-14)19-20-18(15)22-21-12/h2-11H,1H3 |
| InChIKey | JXORTAOQWYCYIN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |