C10H8ClNS — CID 57108416
3-chloro-5-methyl-4-phenyl-1,2-thiazole (PubChem CID 57108416) has the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-phenyl-1,2-thiazole.
| Compound Name | 3-chloro-5-methyl-4-phenyl-1,2-thiazole |
|---|---|
| PubChem CID | 57108416 |
| Molecular Formula | C10H8ClNS |
| Molecular Weight | 209.70 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 3-chloro-5-methyl-4-phenyl-1,2-thiazole |
| SMILES | Cc1snc(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C10H8ClNS/c1-7-9(10(11)12-13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | IWHDJVJWBONHKV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |