C13H8ClNS — CID 129031299
3-chloro-6-phenyl-1,2-benzothiazole (PubChem CID 129031299) has the molecular formula C13H8ClNS and a molecular weight of 245.73 g/mol. Its IUPAC name is 3-chloro-6-phenyl-1,2-benzothiazole.
| Compound Name | 3-chloro-6-phenyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 129031299 |
| Molecular Formula | C13H8ClNS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 3-chloro-6-phenyl-1,2-benzothiazole |
| SMILES | Clc1nsc2cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C13H8ClNS/c14-13-11-7-6-10(8-12(11)16-15-13)9-4-2-1-3-5-9/h1-8H |
| InChIKey | UIMCLCYLUVDNHQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |