About 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine
5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine (PubChem CID 59007781) has the molecular formula C12H8BrCl2N
and a molecular weight of 317.01 g/mol. Its IUPAC name is 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine |
| PubChem CID | 59007781 |
| Molecular Formula | C12H8BrCl2N |
| Molecular Weight | 317.01 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine |
| SMILES | Cc1nc(Cl)c(-c2ccccc2)c(Cl)c1Br |
| InChI | InChI=1S/C12H8BrCl2N/c1-7-10(13)11(14)9(12(15)16-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | YVCVPEFLDJMHBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.01 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine?
The IUPAC name of 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine (CID 59007781) is 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine.
What is the SMILES notation for 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine?
The canonical SMILES for 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine is Cc1nc(Cl)c(-c2ccccc2)c(Cl)c1Br.
What is the InChIKey of 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine?
The InChIKey is YVCVPEFLDJMHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrCl2N/c1-7-10(13)11(14)9(12(15)16-7)8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine?
5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine has a molecular weight of 317.01 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine is sourced from PubChem (CID 59007781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).