C12H8BrCl2N — CID 59007781
5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine (PubChem CID 59007781) has the molecular formula C12H8BrCl2N and a molecular weight of 317.01 g/mol. Its IUPAC name is 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine.
| Compound Name | 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine |
|---|---|
| PubChem CID | 59007781 |
| Molecular Formula | C12H8BrCl2N |
| Molecular Weight | 317.01 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | 5-bromo-2,4-dichloro-6-methyl-3-phenylpyridine |
| SMILES | Cc1nc(Cl)c(-c2ccccc2)c(Cl)c1Br |
| InChI | InChI=1S/C12H8BrCl2N/c1-7-10(13)11(14)9(12(15)16-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | YVCVPEFLDJMHBQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.01 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|