C12H7BrCl2 — CID 54302815
5-bromo-1,3-dichloro-2-phenylbenzene (PubChem CID 54302815) has the molecular formula C12H7BrCl2 and a molecular weight of 302.00 g/mol. Its IUPAC name is 5-bromo-1,3-dichloro-2-phenylbenzene.
| Compound Name | 5-bromo-1,3-dichloro-2-phenylbenzene |
|---|---|
| PubChem CID | 54302815 |
| Molecular Formula | C12H7BrCl2 |
| Molecular Weight | 302.00 g/mol |
| Exact Mass | 299.91 |
| IUPAC Name | 5-bromo-1,3-dichloro-2-phenylbenzene |
| SMILES | Clc1cc(Br)cc(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C12H7BrCl2/c13-9-6-10(14)12(11(15)7-9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | SFKXKAYXLZSRFJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |