C18H12Br2 — CID 142746562
2,5-dibromo-1,3-diphenylbenzene (PubChem CID 142746562) has the molecular formula C18H12Br2 and a molecular weight of 388.10 g/mol. Its IUPAC name is 2,5-dibromo-1,3-diphenylbenzene.
| Compound Name | 2,5-dibromo-1,3-diphenylbenzene |
|---|---|
| PubChem CID | 142746562 |
| Molecular Formula | C18H12Br2 |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 2,5-dibromo-1,3-diphenylbenzene |
| SMILES | Brc1cc(-c2ccccc2)c(Br)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H12Br2/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | RDDJMUFCZHALPI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |