C12H8Br2 — CID 3014933
1,3-dibromo-5-phenylbenzene (PubChem CID 3014933) has the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. Its IUPAC name is 1,3-dibromo-5-phenylbenzene.
| Compound Name | 1,3-dibromo-5-phenylbenzene |
|---|---|
| PubChem CID | 3014933 |
| Molecular Formula | C12H8Br2 |
| Molecular Weight | 312.00 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 1,3-dibromo-5-phenylbenzene |
| SMILES | Brc1cc(Br)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H8Br2/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-8H |
| InChIKey | HIHYAKDOWUFGBK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.00 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |