C26H24BBr3O2 — CID 159242843
1-bromo-3-methyl-5-phenylbenzene;1,3-dibromo-5-methylbenzene;phenylboronic acid (PubChem CID 159242843) has the molecular formula C26H24BBr3O2 and a molecular weight of 619.00 g/mol. Its IUPAC name is 1-bromo-3-methyl-5-phenylbenzene;1,3-dibromo-5-methylbenzene;phenylboronic acid.
| Compound Name | 1-bromo-3-methyl-5-phenylbenzene;1,3-dibromo-5-methylbenzene;phenylboronic acid |
|---|---|
| PubChem CID | 159242843 |
| Molecular Formula | C26H24BBr3O2 |
| Molecular Weight | 619.00 g/mol |
| Exact Mass | 615.94 |
| IUPAC Name | 1-bromo-3-methyl-5-phenylbenzene;1,3-dibromo-5-methylbenzene;phenylboronic acid |
| SMILES | Cc1cc(Br)cc(-c2ccccc2)c1.Cc1cc(Br)cc(Br)c1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C13H11Br.C7H6Br2.C6H7BO2/c1-10-7-12(9-13(14)8-10)11-5-3-2-4-6-11;1-5-2-6(8)4-7(9)3-5;8-7(9)6-4-2-1-3-5-6/h2-9H,1H3;2-4H,1H3;1-5,8-9H |
| InChIKey | KUHQMLBMCKYKAD-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.00 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|