C22H12Br4 — CID 155342029
1,4,5,8-tetrabromo-2,6-diphenylnaphthalene (PubChem CID 155342029) has the molecular formula C22H12Br4 and a molecular weight of 595.95 g/mol. Its IUPAC name is 1,4,5,8-tetrabromo-2,6-diphenylnaphthalene.
| Compound Name | 1,4,5,8-tetrabromo-2,6-diphenylnaphthalene |
|---|---|
| PubChem CID | 155342029 |
| Molecular Formula | C22H12Br4 |
| Molecular Weight | 595.95 g/mol |
| Exact Mass | 591.77 |
| IUPAC Name | 1,4,5,8-tetrabromo-2,6-diphenylnaphthalene |
| SMILES | Brc1cc(-c2ccccc2)c(Br)c2c(Br)cc(-c3ccccc3)c(Br)c12 |
| InChI | InChI=1S/C22H12Br4/c23-17-11-15(13-7-3-1-4-8-13)21(25)19-18(24)12-16(22(26)20(17)19)14-9-5-2-6-10-14/h1-12H |
| InChIKey | CAVCAKXXOVFNSC-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.95 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |