About 1-bromo-2-ethenyl-3,4,5-triphenylbenzene
1-bromo-2-ethenyl-3,4,5-triphenylbenzene (PubChem CID 175315549) has the molecular formula C26H19Br
and a molecular weight of 411.34 g/mol. Its IUPAC name is 1-bromo-2-ethenyl-3,4,5-triphenylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-ethenyl-3,4,5-triphenylbenzene |
| PubChem CID | 175315549 |
| Molecular Formula | C26H19Br |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-bromo-2-ethenyl-3,4,5-triphenylbenzene |
| SMILES | C=Cc1c(Br)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H19Br/c1-2-22-24(27)18-23(19-12-6-3-7-13-19)26(21-16-10-5-11-17-21)25(22)20-14-8-4-9-15-20/h2-18H,1H2 |
| InChIKey | RIVBEPSALRSWGE-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-ethenyl-3,4,5-triphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-ethenyl-3,4,5-triphenylbenzene?
The IUPAC name of 1-bromo-2-ethenyl-3,4,5-triphenylbenzene (CID 175315549) is 1-bromo-2-ethenyl-3,4,5-triphenylbenzene.
What is the SMILES notation for 1-bromo-2-ethenyl-3,4,5-triphenylbenzene?
The canonical SMILES for 1-bromo-2-ethenyl-3,4,5-triphenylbenzene is C=Cc1c(Br)cc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-bromo-2-ethenyl-3,4,5-triphenylbenzene?
The InChIKey is RIVBEPSALRSWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19Br/c1-2-22-24(27)18-23(19-12-6-3-7-13-19)26(21-16-10-5-11-17-21)25(22)20-14-8-4-9-15-20/h2-18H,1H2.
What are the key properties of 1-bromo-2-ethenyl-3,4,5-triphenylbenzene?
1-bromo-2-ethenyl-3,4,5-triphenylbenzene has a molecular weight of 411.34 g/mol, XLogP of 8.09, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-ethenyl-3,4,5-triphenylbenzene is sourced from PubChem (CID 175315549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).