C28H22 — CID 145266623
2,3-bis(ethenyl)-5-methylidene-1,4-diphenylbenzo[7]annulene (PubChem CID 145266623) has the molecular formula C28H22 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-methylidene-1,4-diphenylbenzo[7]annulene.
| Compound Name | 2,3-bis(ethenyl)-5-methylidene-1,4-diphenylbenzo[7]annulene |
|---|---|
| PubChem CID | 145266623 |
| Molecular Formula | C28H22 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2,3-bis(ethenyl)-5-methylidene-1,4-diphenylbenzo[7]annulene |
| SMILES | C=Cc1c(C=C)c(-c2ccccc2)c2c(c1-c1ccccc1)C=CC=CC2=C |
| InChI | InChI=1S/C28H22/c1-4-23-24(5-2)28(22-17-10-7-11-18-22)26-20(3)14-12-13-19-25(26)27(23)21-15-8-6-9-16-21/h4-19H,1-3H2 |
| InChIKey | YRUVQENVHSIFQE-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |