C28H26 — CID 145266518
1,2-bis(ethenyl)-4-methyl-5-[(2Z)-penta-2,4-dien-2-yl]-3,6-diphenylbenzene (PubChem CID 145266518) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4-methyl-5-[(2Z)-penta-2,4-dien-2-yl]-3,6-diphenylbenzene.
| Compound Name | 1,2-bis(ethenyl)-4-methyl-5-[(2Z)-penta-2,4-dien-2-yl]-3,6-diphenylbenzene |
|---|---|
| PubChem CID | 145266518 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1,2-bis(ethenyl)-4-methyl-5-[(2Z)-penta-2,4-dien-2-yl]-3,6-diphenylbenzene |
| SMILES | C=C/C=C(/C)c1c(C)c(-c2ccccc2)c(C=C)c(C=C)c1-c1ccccc1 |
| InChI | InChI=1S/C28H26/c1-6-15-20(4)26-21(5)27(22-16-11-9-12-17-22)24(7-2)25(8-3)28(26)23-18-13-10-14-19-23/h6-19H,1-3H2,4-5H3/b20-15- |
| InChIKey | FOCSPLAKSODZJW-HKWRFOASSA-N |
| XLogP | 8.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|