C26H25NO3 — CID 25034225
ethyl 3-anilino-5-[(1Z)-buta-1,3-dienyl]-4-hydroxy-2-methyl-6-phenylbenzoate (PubChem CID 25034225) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 3-anilino-5-[(1Z)-buta-1,3-dienyl]-4-hydroxy-2-methyl-6-phenylbenzoate.
| Compound Name | ethyl 3-anilino-5-[(1Z)-buta-1,3-dienyl]-4-hydroxy-2-methyl-6-phenylbenzoate |
|---|---|
| PubChem CID | 25034225 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 3-anilino-5-[(1Z)-buta-1,3-dienyl]-4-hydroxy-2-methyl-6-phenylbenzoate |
| SMILES | C=C/C=C\c1c(O)c(Nc2ccccc2)c(C)c(C(=O)OCC)c1-c1ccccc1 |
| InChI | InChI=1S/C26H25NO3/c1-4-6-17-21-23(19-13-9-7-10-14-19)22(26(29)30-5-2)18(3)24(25(21)28)27-20-15-11-8-12-16-20/h4,6-17,27-28H,1,5H2,2-3H3/b17-6- |
| InChIKey | ZRWKYGJZEGIYGS-FMQZQXMHSA-N |
| XLogP | 6.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|