C28H21Cl2NO3S — CID 164627768
ethyl 2-anilino-5-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-phenylthiophene-3-carboxylate (PubChem CID 164627768) has the molecular formula C28H21Cl2NO3S and a molecular weight of 522.45 g/mol. Its IUPAC name is ethyl 2-anilino-5-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-anilino-5-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 164627768 |
| Molecular Formula | C28H21Cl2NO3S |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | ethyl 2-anilino-5-[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccccc2)sc(C(=O)/C=C/c2ccc(Cl)c(Cl)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H21Cl2NO3S/c1-2-34-28(33)25-24(19-9-5-3-6-10-19)26(35-27(25)31-20-11-7-4-8-12-20)23(32)16-14-18-13-15-21(29)22(30)17-18/h3-17,31H,2H2,1H3/b16-14+ |
| InChIKey | BDBOBRHHKLYIGS-JQIJEIRASA-N |
| XLogP | 8.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|