C23H20N4O2S — CID 164628074
ethyl 5-(2-aminopyrimidin-4-yl)-2-anilino-4-phenylthiophene-3-carboxylate (PubChem CID 164628074) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is ethyl 5-(2-aminopyrimidin-4-yl)-2-anilino-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-anilino-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 164628074 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | ethyl 5-(2-aminopyrimidin-4-yl)-2-anilino-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccccc2)sc(-c2ccnc(N)n2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O2S/c1-2-29-22(28)19-18(15-9-5-3-6-10-15)20(17-13-14-25-23(24)27-17)30-21(19)26-16-11-7-4-8-12-16/h3-14,26H,2H2,1H3,(H2,24,25,27) |
| InChIKey | SSXRJJBKBVEUBD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |