C16H19ClN2O3S — CID 170892715
ethyl 5-(2-amino-3-hydroxypropyl)-2-anilino-4-chlorothiophene-3-carboxylate (PubChem CID 170892715) has the molecular formula C16H19ClN2O3S and a molecular weight of 354.86 g/mol. Its IUPAC name is ethyl 5-(2-amino-3-hydroxypropyl)-2-anilino-4-chlorothiophene-3-carboxylate.
| Compound Name | ethyl 5-(2-amino-3-hydroxypropyl)-2-anilino-4-chlorothiophene-3-carboxylate |
|---|---|
| PubChem CID | 170892715 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | ethyl 5-(2-amino-3-hydroxypropyl)-2-anilino-4-chlorothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccccc2)sc(CC(N)CO)c1Cl |
| InChI | InChI=1S/C16H19ClN2O3S/c1-2-22-16(21)13-14(17)12(8-10(18)9-20)23-15(13)19-11-6-4-3-5-7-11/h3-7,10,19-20H,2,8-9,18H2,1H3 |
| InChIKey | LAUACCDQWQNSTC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |