C14H16N2O2S — CID 10754942
ethyl 2-anilino-5-methyl-6H-1,3-thiazine-4-carboxylate (PubChem CID 10754942) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is ethyl 2-anilino-5-methyl-6H-1,3-thiazine-4-carboxylate.
| Compound Name | ethyl 2-anilino-5-methyl-6H-1,3-thiazine-4-carboxylate |
|---|---|
| PubChem CID | 10754942 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | ethyl 2-anilino-5-methyl-6H-1,3-thiazine-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)CSC(Nc2ccccc2)=N1 |
| InChI | InChI=1S/C14H16N2O2S/c1-3-18-13(17)12-10(2)9-19-14(16-12)15-11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3,(H,15,16) |
| InChIKey | VLSSPTMCIJNCTP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |