C15H18N4O2S — CID 56693351
ethyl 4-anilino-6-ethylsulfanyl-1H-1,3,5-triazepine-7-carboxylate (PubChem CID 56693351) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is ethyl 4-anilino-6-ethylsulfanyl-1H-1,3,5-triazepine-7-carboxylate.
| Compound Name | ethyl 4-anilino-6-ethylsulfanyl-1H-1,3,5-triazepine-7-carboxylate |
|---|---|
| PubChem CID | 56693351 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | ethyl 4-anilino-6-ethylsulfanyl-1H-1,3,5-triazepine-7-carboxylate |
| SMILES | CCOC(=O)C1=C(SCC)N=C(Nc2ccccc2)N=CN1 |
| InChI | InChI=1S/C15H18N4O2S/c1-3-21-14(20)12-13(22-4-2)19-15(17-10-16-12)18-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | GYDQPZBOFSSOFZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |