C26H25NO3 — CID 25034226
ethyl 8-anilino-2,7-dimethyl-5-phenyl-2H-chromene-6-carboxylate (PubChem CID 25034226) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 8-anilino-2,7-dimethyl-5-phenyl-2H-chromene-6-carboxylate.
| Compound Name | ethyl 8-anilino-2,7-dimethyl-5-phenyl-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 25034226 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 8-anilino-2,7-dimethyl-5-phenyl-2H-chromene-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(Nc2ccccc2)c2c(c1-c1ccccc1)C=CC(C)O2 |
| InChI | InChI=1S/C26H25NO3/c1-4-29-26(28)22-18(3)24(27-20-13-9-6-10-14-20)25-21(16-15-17(2)30-25)23(22)19-11-7-5-8-12-19/h5-17,27H,4H2,1-3H3 |
| InChIKey | GXXZTUJHSJOFAU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |