C22H20N2O4 — CID 156598657
ethyl 5-benzamido-2-methyl-6-oxo-4-phenyl-1H-pyridine-3-carboxylate (PubChem CID 156598657) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl 5-benzamido-2-methyl-6-oxo-4-phenyl-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 5-benzamido-2-methyl-6-oxo-4-phenyl-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 156598657 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl 5-benzamido-2-methyl-6-oxo-4-phenyl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(=O)c(NC(=O)c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c1-3-28-22(27)17-14(2)23-21(26)19(18(17)15-10-6-4-7-11-15)24-20(25)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | XPAGXGWMZFPZMA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |