C30H34 — CID 174013774
1,3-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-5-[(2E)-penta-2,4-dien-2-yl]-2-phenylbenzene (PubChem CID 174013774) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 1,3-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-5-[(2E)-penta-2,4-dien-2-yl]-2-phenylbenzene.
| Compound Name | 1,3-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-5-[(2E)-penta-2,4-dien-2-yl]-2-phenylbenzene |
|---|---|
| PubChem CID | 174013774 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1,3-bis[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-5-[(2E)-penta-2,4-dien-2-yl]-2-phenylbenzene |
| SMILES | C=C/C=C(\C)c1cc(C(/C=C\C)=C/C)c(-c2ccccc2)c(C(/C=C\C)=C/C)c1C |
| InChI | InChI=1S/C30H34/c1-8-16-22(6)27-21-28(24(11-4)17-9-2)30(26-19-14-13-15-20-26)29(23(27)7)25(12-5)18-10-3/h8-21H,1H2,2-7H3/b17-9-,18-10-,22-16+,24-11+,25-12+ |
| InChIKey | RFEVWHNAVYDIFY-ZWBOEGKBSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|