C20H28 — CID 142907350
cyclopropane;1-[(2E)-penta-2,4-dien-2-yl]-2-prop-1-en-2-ylbenzene;prop-1-ene (PubChem CID 142907350) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is cyclopropane;1-[(2E)-penta-2,4-dien-2-yl]-2-prop-1-en-2-ylbenzene;prop-1-ene.
| Compound Name | cyclopropane;1-[(2E)-penta-2,4-dien-2-yl]-2-prop-1-en-2-ylbenzene;prop-1-ene |
|---|---|
| PubChem CID | 142907350 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | cyclopropane;1-[(2E)-penta-2,4-dien-2-yl]-2-prop-1-en-2-ylbenzene;prop-1-ene |
| SMILES | C1CC1.C=C/C=C(\C)c1ccccc1C(=C)C.C=CC |
| InChI | InChI=1S/C14H16.2C3H6/c1-5-8-12(4)14-10-7-6-9-13(14)11(2)3;1-2-3-1;1-3-2/h5-10H,1-2H2,3-4H3;1-3H2;3H,1H2,2H3/b12-8+;; |
| InChIKey | CSXYJVVMFYYRHQ-BPWZRWDXSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|