C21H27N — CID 143367393
2-ethenyl-1-[1-[2-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]ethenyl]pyrrolidine (PubChem CID 143367393) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-ethenyl-1-[1-[2-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]ethenyl]pyrrolidine.
| Compound Name | 2-ethenyl-1-[1-[2-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]ethenyl]pyrrolidine |
|---|---|
| PubChem CID | 143367393 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-ethenyl-1-[1-[2-[(2E)-5-methylhexa-2,4-dien-2-yl]phenyl]ethenyl]pyrrolidine |
| SMILES | C=CC1CCCN1C(=C)c1ccccc1/C(C)=C/C=C(C)C |
| InChI | InChI=1S/C21H27N/c1-6-19-10-9-15-22(19)18(5)21-12-8-7-11-20(21)17(4)14-13-16(2)3/h6-8,11-14,19H,1,5,9-10,15H2,2-4H3/b17-14+ |
| InChIKey | ULOGEHJAFKHJST-SAPNQHFASA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|