C13H16INO — CID 55137776
(2-ethylpyrrolidin-1-yl)-(2-iodophenyl)methanone (PubChem CID 55137776) has the molecular formula C13H16INO and a molecular weight of 329.18 g/mol. Its IUPAC name is (2-ethylpyrrolidin-1-yl)-(2-iodophenyl)methanone.
| Compound Name | (2-ethylpyrrolidin-1-yl)-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 55137776 |
| Molecular Formula | C13H16INO |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (2-ethylpyrrolidin-1-yl)-(2-iodophenyl)methanone |
| SMILES | CCC1CCCN1C(=O)c1ccccc1I |
| InChI | InChI=1S/C13H16INO/c1-2-10-6-5-9-15(10)13(16)11-7-3-4-8-12(11)14/h3-4,7-8,10H,2,5-6,9H2,1H3 |
| InChIKey | ZSLRASUJCQIFCJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|