About ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine
ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine (PubChem CID 143162626) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine |
| PubChem CID | 143162626 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine |
| SMILES | C=C(C)c1ccccc1/C(=C/C)NC.C=CN |
| InChI | InChI=1S/C13H17N.C2H5N/c1-5-13(14-4)12-9-7-6-8-11(12)10(2)3;1-2-3/h5-9,14H,2H2,1,3-4H3;2H,1,3H2/b13-5-; |
| InChIKey | DNIXQRIJLHLUDR-UCHKSFBOSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine?
The IUPAC name of ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine (CID 143162626) is ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine.
What is the SMILES notation for ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine?
The canonical SMILES for ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine is C=C(C)c1ccccc1/C(=C/C)NC.C=CN.
What is the InChIKey of ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine?
The InChIKey is DNIXQRIJLHLUDR-UCHKSFBOSA-N. The full InChI is InChI=1S/C13H17N.C2H5N/c1-5-13(14-4)12-9-7-6-8-11(12)10(2)3;1-2-3/h5-9,14H,2H2,1,3-4H3;2H,1,3H2/b13-5-;.
What are the key properties of ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine?
ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine has a molecular weight of 230.35 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;(Z)-N-methyl-1-(2-prop-1-en-2-ylphenyl)prop-1-en-1-amine is sourced from PubChem (CID 143162626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).