C56H45N — CID 143539879
N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-methylphenyl)-2-phenylnaphthalen-1-yl]phenyl]-N-phenyl-4-[(E)-2-phenylethenyl]aniline (PubChem CID 143539879) has the molecular formula C56H45N and a molecular weight of 731.98 g/mol. Its IUPAC name is N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-methylphenyl)-2-phenylnaphthalen-1-yl]phenyl]-N-phenyl-4-[(E)-2-phenylethenyl]aniline.
| Compound Name | N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-methylphenyl)-2-phenylnaphthalen-1-yl]phenyl]-N-phenyl-4-[(E)-2-phenylethenyl]aniline |
|---|---|
| PubChem CID | 143539879 |
| Molecular Formula | C56H45N |
| Molecular Weight | 731.98 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | N-[4-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-(4-methylphenyl)-2-phenylnaphthalen-1-yl]phenyl]-N-phenyl-4-[(E)-2-phenylethenyl]aniline |
| SMILES | C=C/C=C(\C=C/C)c1c(-c2ccccc2)c(-c2ccc(N(c3ccccc3)c3ccc(/C=C/c4ccccc4)cc3)cc2)c2ccccc2c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C56H45N/c1-4-17-44(18-5-2)55-53(46-33-27-41(3)28-34-46)51-25-15-16-26-52(51)54(56(55)45-21-11-7-12-22-45)47-35-39-50(40-36-47)57(48-23-13-8-14-24-48)49-37-31-43(32-38-49)30-29-42-19-9-6-10-20-42/h4-40H,1H2,2-3H3/b18-5-,30-29+,44-17+ |
| InChIKey | UWPINTMSLWRCSN-WHSMNUBVSA-N |
| XLogP | 15.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.98 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|