C54H42N2 — CID 142312572
N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-[4-(2-methyl-3-phenylpyrrolo[1,2-f]phenanthridin-1-yl)phenyl]-4-phenylaniline (PubChem CID 142312572) has the molecular formula C54H42N2 and a molecular weight of 718.94 g/mol. Its IUPAC name is N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-[4-(2-methyl-3-phenylpyrrolo[1,2-f]phenanthridin-1-yl)phenyl]-4-phenylaniline.
| Compound Name | N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-[4-(2-methyl-3-phenylpyrrolo[1,2-f]phenanthridin-1-yl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 142312572 |
| Molecular Formula | C54H42N2 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | N-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-N-[4-(2-methyl-3-phenylpyrrolo[1,2-f]phenanthridin-1-yl)phenyl]-4-phenylaniline |
| SMILES | C=C/C=C(\C=C/C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3c(C)c(-c4ccccc4)n4c5ccccc5c5ccccc5c34)cc2)cc1 |
| InChI | InChI=1S/C54H42N2/c1-4-16-39(17-5-2)41-26-32-45(33-27-41)55(46-34-28-42(29-35-46)40-18-8-6-9-19-40)47-36-30-43(31-37-47)52-38(3)53(44-20-10-7-11-21-44)56-51-25-15-14-23-49(51)48-22-12-13-24-50(48)54(52)56/h4-37H,1H2,2-3H3/b17-5-,39-16+ |
| InChIKey | JFJGQXCSXDKDGE-ZLYURMHFSA-N |
| XLogP | 15.17 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|