C40H34 — CID 143742639
1-[2-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylnaphthalen-1-yl]phenyl]-2-methyl-4-phenylnaphthalene (PubChem CID 143742639) has the molecular formula C40H34 and a molecular weight of 514.71 g/mol. Its IUPAC name is 1-[2-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylnaphthalen-1-yl]phenyl]-2-methyl-4-phenylnaphthalene.
| Compound Name | 1-[2-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylnaphthalen-1-yl]phenyl]-2-methyl-4-phenylnaphthalene |
|---|---|
| PubChem CID | 143742639 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 1-[2-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-methylnaphthalen-1-yl]phenyl]-2-methyl-4-phenylnaphthalene |
| SMILES | C/C=C\C(=C/C)c1cc(C)c(-c2ccccc2-c2c(C)cc(-c3ccccc3)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C40H34/c1-5-16-29(6-2)37-25-27(3)39(33-21-12-10-19-31(33)37)35-23-14-15-24-36(35)40-28(4)26-38(30-17-8-7-9-18-30)32-20-11-13-22-34(32)40/h5-26H,1-4H3/b16-5-,29-6+ |
| InChIKey | QLPZEWGHPHLGRH-SCSAURLPSA-N |
| XLogP | 11.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|