About 3-ethenyl-2,4,6-triphenylphenol
3-ethenyl-2,4,6-triphenylphenol (PubChem CID 174543439) has the molecular formula C26H20O
and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-ethenyl-2,4,6-triphenylphenol.
Molecular Properties
| Compound Name | 3-ethenyl-2,4,6-triphenylphenol |
| PubChem CID | 174543439 |
| Molecular Formula | C26H20O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-ethenyl-2,4,6-triphenylphenol |
| SMILES | C=Cc1c(-c2ccccc2)cc(-c2ccccc2)c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C26H20O/c1-2-22-23(19-12-6-3-7-13-19)18-24(20-14-8-4-9-15-20)26(27)25(22)21-16-10-5-11-17-21/h2-18,27H,1H2 |
| InChIKey | ASFCQLNVBFMPAR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-2,4,6-triphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2,4,6-triphenylphenol?
The IUPAC name of 3-ethenyl-2,4,6-triphenylphenol (CID 174543439) is 3-ethenyl-2,4,6-triphenylphenol.
What is the SMILES notation for 3-ethenyl-2,4,6-triphenylphenol?
The canonical SMILES for 3-ethenyl-2,4,6-triphenylphenol is C=Cc1c(-c2ccccc2)cc(-c2ccccc2)c(O)c1-c1ccccc1.
What is the InChIKey of 3-ethenyl-2,4,6-triphenylphenol?
The InChIKey is ASFCQLNVBFMPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20O/c1-2-22-23(19-12-6-3-7-13-19)18-24(20-14-8-4-9-15-20)26(27)25(22)21-16-10-5-11-17-21/h2-18,27H,1H2.
What are the key properties of 3-ethenyl-2,4,6-triphenylphenol?
3-ethenyl-2,4,6-triphenylphenol has a molecular weight of 348.45 g/mol, XLogP of 7.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2,4,6-triphenylphenol is sourced from PubChem (CID 174543439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).