C47H44N2 — CID 89267306
2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-N,1-N,4-N,4-N-tetrakis(3-methylphenyl)-3-phenylbenzene-1,4-diamine (PubChem CID 89267306) has the molecular formula C47H44N2 and a molecular weight of 636.88 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-N,1-N,4-N,4-N-tetrakis(3-methylphenyl)-3-phenylbenzene-1,4-diamine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-N,1-N,4-N,4-N-tetrakis(3-methylphenyl)-3-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 89267306 |
| Molecular Formula | C47H44N2 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-N,1-N,4-N,4-N-tetrakis(3-methylphenyl)-3-phenylbenzene-1,4-diamine |
| SMILES | C=C/C=C\C=C(/C)c1c(N(c2cccc(C)c2)c2cccc(C)c2)ccc(N(c2cccc(C)c2)c2cccc(C)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C47H44N2/c1-7-8-10-21-38(6)46-44(48(40-24-13-17-34(2)30-40)41-25-14-18-35(3)31-41)28-29-45(47(46)39-22-11-9-12-23-39)49(42-26-15-19-36(4)32-42)43-27-16-20-37(5)33-43/h7-33H,1H2,2-6H3/b10-8-,38-21+ |
| InChIKey | GAHSQUOTAAJEKB-DFKBBORLSA-N |
| XLogP | 13.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|