C18H12 — CID 19931086
2,3-diphenylbicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 19931086) has the molecular formula C18H12 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2,3-diphenylbicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 2,3-diphenylbicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 19931086 |
| Molecular Formula | C18H12 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,3-diphenylbicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | c1ccc(-c2cc3cc-3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H12/c1-3-7-13(8-4-1)16-11-15-12-17(15)18(16)14-9-5-2-6-10-14/h1-12H |
| InChIKey | HSXNOMZUHLQPKP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |